C21H23Cl2N3O2S2 — CID 17115871
6-tert-butyl-2-[(3,4-dichlorobenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 17115871) has the molecular formula C21H23Cl2N3O2S2 and a molecular weight of 484.47 g/mol. Its IUPAC name is 6-tert-butyl-2-[(3,4-dichlorobenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-tert-butyl-2-[(3,4-dichlorobenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17115871 |
| Molecular Formula | C21H23Cl2N3O2S2 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 6-tert-butyl-2-[(3,4-dichlorobenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)C1CCc2c(sc(NC(=S)NC(=O)c3ccc(Cl)c(Cl)c3)c2C(N)=O)C1 |
| InChI | InChI=1S/C21H23Cl2N3O2S2/c1-21(2,3)11-5-6-12-15(9-11)30-19(16(12)17(24)27)26-20(29)25-18(28)10-4-7-13(22)14(23)8-10/h4,7-8,11H,5-6,9H2,1-3H3,(H2,24,27)(H2,25,26,28,29) |
| InChIKey | ALJXMDQXBYIHGD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|