C22H26ClN3O2S2 — CID 17109939
6-tert-butyl-2-[(3-chloro-4-methylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 17109939) has the molecular formula C22H26ClN3O2S2 and a molecular weight of 464.06 g/mol. Its IUPAC name is 6-tert-butyl-2-[(3-chloro-4-methylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-tert-butyl-2-[(3-chloro-4-methylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17109939 |
| Molecular Formula | C22H26ClN3O2S2 |
| Molecular Weight | 464.06 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 6-tert-butyl-2-[(3-chloro-4-methylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2sc3c(c2C(N)=O)CCC(C(C)(C)C)C3)cc1Cl |
| InChI | InChI=1S/C22H26ClN3O2S2/c1-11-5-6-12(9-15(11)23)19(28)25-21(29)26-20-17(18(24)27)14-8-7-13(22(2,3)4)10-16(14)30-20/h5-6,9,13H,7-8,10H2,1-4H3,(H2,24,27)(H2,25,26,28,29) |
| InChIKey | LJZDWVUDEUKVQE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.06 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|