C27H29N3O2S2 — CID 40860953
(6S)-6-tert-butyl-2-[(4-phenylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 40860953) has the molecular formula C27H29N3O2S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[(4-phenylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-2-[(4-phenylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 40860953 |
| Molecular Formula | C27H29N3O2S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (6S)-6-tert-butyl-2-[(4-phenylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(NC(=S)NC(=O)c3ccc(-c4ccccc4)cc3)c2C(N)=O)C1 |
| InChI | InChI=1S/C27H29N3O2S2/c1-27(2,3)19-13-14-20-21(15-19)34-25(22(20)23(28)31)30-26(33)29-24(32)18-11-9-17(10-12-18)16-7-5-4-6-8-16/h4-12,19H,13-15H2,1-3H3,(H2,28,31)(H2,29,30,32,33)/t19-/m0/s1 |
| InChIKey | RDYBJSOIPNBJRI-IBGZPJMESA-N |
| XLogP | 5.79 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|