C23H27N3O2S2 — CID 4933944
N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-4-hexoxybenzamide (PubChem CID 4933944) has the molecular formula C23H27N3O2S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-4-hexoxybenzamide.
| Compound Name | N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4933944 |
| Molecular Formula | C23H27N3O2S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2sc3c(c2C#N)CCCC3)cc1 |
| InChI | InChI=1S/C23H27N3O2S2/c1-2-3-4-7-14-28-17-12-10-16(11-13-17)21(27)25-23(29)26-22-19(15-24)18-8-5-6-9-20(18)30-22/h10-13H,2-9,14H2,1H3,(H2,25,26,27,29) |
| InChIKey | MJVGSUJLMZPUMT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|