C18H17N3O2S2 — CID 4778900
N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-2-methoxybenzamide (PubChem CID 4778900) has the molecular formula C18H17N3O2S2 and a molecular weight of 371.49 g/mol. Its IUPAC name is N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-2-methoxybenzamide.
| Compound Name | N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4778900 |
| Molecular Formula | C18H17N3O2S2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(=S)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C18H17N3O2S2/c1-23-14-8-4-2-7-12(14)16(22)20-18(24)21-17-13(10-19)11-6-3-5-9-15(11)25-17/h2,4,7-8H,3,5-6,9H2,1H3,(H2,20,21,22,24) |
| InChIKey | IXIYHKDVLQAHIL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|