C20H22N2O3S — CID 5176968
N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2,4-dimethoxybenzamide (PubChem CID 5176968) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2,4-dimethoxybenzamide.
| Compound Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 5176968 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2sc3c(c2C#N)CCCCCC3)c(OC)c1 |
| InChI | InChI=1S/C20H22N2O3S/c1-24-13-9-10-15(17(11-13)25-2)19(23)22-20-16(12-21)14-7-5-3-4-6-8-18(14)26-20/h9-11H,3-8H2,1-2H3,(H,22,23) |
| InChIKey | BMTRKXOKIMSDKH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |