C22H24BrN3O2S2 — CID 17351003
5-bromo-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-2-(3-methylbutoxy)benzamide (PubChem CID 17351003) has the molecular formula C22H24BrN3O2S2 and a molecular weight of 506.49 g/mol. Its IUPAC name is 5-bromo-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-2-(3-methylbutoxy)benzamide.
| Compound Name | 5-bromo-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17351003 |
| Molecular Formula | C22H24BrN3O2S2 |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | 5-bromo-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-2-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C22H24BrN3O2S2/c1-13(2)9-10-28-18-8-7-14(23)11-16(18)20(27)25-22(29)26-21-17(12-24)15-5-3-4-6-19(15)30-21/h7-8,11,13H,3-6,9-10H2,1-2H3,(H2,25,26,27,29) |
| InChIKey | BVDKSINHHNOWLZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|