C21H23BrN2O3S — CID 17350967
N-[(4-acetylphenyl)carbamothioyl]-5-bromo-2-(3-methylbutoxy)benzamide (PubChem CID 17350967) has the molecular formula C21H23BrN2O3S and a molecular weight of 463.40 g/mol. Its IUPAC name is N-[(4-acetylphenyl)carbamothioyl]-5-bromo-2-(3-methylbutoxy)benzamide.
| Compound Name | N-[(4-acetylphenyl)carbamothioyl]-5-bromo-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17350967 |
| Molecular Formula | C21H23BrN2O3S |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-[(4-acetylphenyl)carbamothioyl]-5-bromo-2-(3-methylbutoxy)benzamide |
| SMILES | CC(=O)c1ccc(NC(=S)NC(=O)c2cc(Br)ccc2OCCC(C)C)cc1 |
| InChI | InChI=1S/C21H23BrN2O3S/c1-13(2)10-11-27-19-9-6-16(22)12-18(19)20(26)24-21(28)23-17-7-4-15(5-8-17)14(3)25/h4-9,12-13H,10-11H2,1-3H3,(H2,23,24,26,28) |
| InChIKey | WYFIUPCBUJVQOV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|