C20H22BrClN2O3S — CID 17351116
5-bromo-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide (PubChem CID 17351116) has the molecular formula C20H22BrClN2O3S and a molecular weight of 485.83 g/mol. Its IUPAC name is 5-bromo-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide.
| Compound Name | 5-bromo-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17351116 |
| Molecular Formula | C20H22BrClN2O3S |
| Molecular Weight | 485.83 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | 5-bromo-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide |
| SMILES | COc1ccc(NC(=S)NC(=O)c2cc(Br)ccc2OCCC(C)C)cc1Cl |
| InChI | InChI=1S/C20H22BrClN2O3S/c1-12(2)8-9-27-17-6-4-13(21)10-15(17)19(25)24-20(28)23-14-5-7-18(26-3)16(22)11-14/h4-7,10-12H,8-9H2,1-3H3,(H2,23,24,25,28) |
| InChIKey | XYHFPYYACQOECI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.83 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|