C22H26BrN3O3S — CID 17232141
5-bromo-N-[[3-(dimethylcarbamoyl)phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide (PubChem CID 17232141) has the molecular formula C22H26BrN3O3S and a molecular weight of 492.44 g/mol. Its IUPAC name is 5-bromo-N-[[3-(dimethylcarbamoyl)phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide.
| Compound Name | 5-bromo-N-[[3-(dimethylcarbamoyl)phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17232141 |
| Molecular Formula | C22H26BrN3O3S |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 5-bromo-N-[[3-(dimethylcarbamoyl)phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C22H26BrN3O3S/c1-14(2)10-11-29-19-9-8-16(23)13-18(19)20(27)25-22(30)24-17-7-5-6-15(12-17)21(28)26(3)4/h5-9,12-14H,10-11H2,1-4H3,(H2,24,25,27,30) |
| InChIKey | VBSFNWPUZRFNDT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|