C27H25BrF3N3O3S — CID 43878294
5-bromo-2-(3-methylbutoxy)-N-[[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 43878294) has the molecular formula C27H25BrF3N3O3S and a molecular weight of 608.48 g/mol. Its IUPAC name is 5-bromo-2-(3-methylbutoxy)-N-[[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-(3-methylbutoxy)-N-[[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 43878294 |
| Molecular Formula | C27H25BrF3N3O3S |
| Molecular Weight | 608.48 g/mol |
| Exact Mass | 607.08 |
| IUPAC Name | 5-bromo-2-(3-methylbutoxy)-N-[[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CC(C)CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H25BrF3N3O3S/c1-16(2)11-12-37-23-10-9-19(28)15-22(23)25(36)34-26(38)33-20-7-3-5-17(13-20)24(35)32-21-8-4-6-18(14-21)27(29,30)31/h3-10,13-16H,11-12H2,1-2H3,(H,32,35)(H2,33,34,36,38) |
| InChIKey | HGBJOQYXMBRQJR-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.48 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|