C20H21IN2OS — CID 2200015
N-[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-iodobenzamide (PubChem CID 2200015) has the molecular formula C20H21IN2OS and a molecular weight of 464.37 g/mol. Its IUPAC name is N-[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-iodobenzamide.
| Compound Name | N-[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 2200015 |
| Molecular Formula | C20H21IN2OS |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | N-[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-iodobenzamide |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(NC(=O)c3ccccc3I)c2C#N)C1 |
| InChI | InChI=1S/C20H21IN2OS/c1-20(2,3)12-8-9-13-15(11-22)19(25-17(13)10-12)23-18(24)14-6-4-5-7-16(14)21/h4-7,12H,8-10H2,1-3H3,(H,23,24)/t12-/m1/s1 |
| InChIKey | WYEGQOGYFJKBLH-GFCCVEGCSA-N |
| XLogP | 5.63 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|