C20H20ClN3O3S — CID 5211019
N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-chloro-5-nitrobenzamide (PubChem CID 5211019) has the molecular formula C20H20ClN3O3S and a molecular weight of 417.92 g/mol. Its IUPAC name is N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-chloro-5-nitrobenzamide.
| Compound Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-chloro-5-nitrobenzamide |
|---|---|
| PubChem CID | 5211019 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-chloro-5-nitrobenzamide |
| SMILES | CC(C)(C)C1CCc2c(sc(NC(=O)c3cc([N+](=O)[O-])ccc3Cl)c2C#N)C1 |
| InChI | InChI=1S/C20H20ClN3O3S/c1-20(2,3)11-4-6-13-15(10-22)19(28-17(13)8-11)23-18(25)14-9-12(24(26)27)5-7-16(14)21/h5,7,9,11H,4,6,8H2,1-3H3,(H,23,25) |
| InChIKey | HQGZRMDHWMCJOE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|