C25H29N5O4S2 — CID 51622520
N-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 51622520) has the molecular formula C25H29N5O4S2 and a molecular weight of 527.67 g/mol. Its IUPAC name is N-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 51622520 |
| Molecular Formula | C25H29N5O4S2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | N-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(NC(=S)NC(=O)c3cc([N+](=O)[O-])ccc3N3CCOCC3)c2C#N)C1 |
| InChI | InChI=1S/C25H29N5O4S2/c1-25(2,3)15-4-6-17-19(14-26)23(36-21(17)12-15)28-24(35)27-22(31)18-13-16(30(32)33)5-7-20(18)29-8-10-34-11-9-29/h5,7,13,15H,4,6,8-12H2,1-3H3,(H2,27,28,31,35)/t15-/m0/s1 |
| InChIKey | RUIYYEYXVRWIEN-HNNXBMFYSA-N |
| XLogP | 4.64 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|