C19H12F16N2O3S — CID 4220873
propan-2-yl 4-cyano-5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoylamino)-3-methylthiophene-2-carboxylate (PubChem CID 4220873) has the molecular formula C19H12F16N2O3S and a molecular weight of 652.35 g/mol. Its IUPAC name is propan-2-yl 4-cyano-5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | propan-2-yl 4-cyano-5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 4220873 |
| Molecular Formula | C19H12F16N2O3S |
| Molecular Weight | 652.35 g/mol |
| Exact Mass | 652.03 |
| IUPAC Name | propan-2-yl 4-cyano-5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoylamino)-3-methylthiophene-2-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)sc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)c1C#N |
| InChI | InChI=1S/C19H12F16N2O3S/c1-5(2)40-10(38)8-6(3)7(4-36)9(41-8)37-12(39)14(24,25)16(28,29)18(32,33)19(34,35)17(30,31)15(26,27)13(22,23)11(20)21/h5,11H,1-3H3,(H,37,39) |
| InChIKey | FVWNRCLXSAALBU-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.35 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|