C12H7F7N2O3S — CID 5220525
methyl 4-cyano-5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-methylthiophene-2-carboxylate (PubChem CID 5220525) has the molecular formula C12H7F7N2O3S and a molecular weight of 392.25 g/mol. Its IUPAC name is methyl 4-cyano-5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | methyl 4-cyano-5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 5220525 |
| Molecular Formula | C12H7F7N2O3S |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | methyl 4-cyano-5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c(C#N)c1C |
| InChI | InChI=1S/C12H7F7N2O3S/c1-4-5(3-20)7(25-6(4)8(22)24-2)21-9(23)10(13,14)11(15,16)12(17,18)19/h1-2H3,(H,21,23) |
| InChIKey | KAKPUTRTVVCVJG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|