C17H24N2O3S — CID 4586360
methyl 4-cyano-3-methyl-5-(nonanoylamino)thiophene-2-carboxylate (PubChem CID 4586360) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is methyl 4-cyano-3-methyl-5-(nonanoylamino)thiophene-2-carboxylate.
| Compound Name | methyl 4-cyano-3-methyl-5-(nonanoylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4586360 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | methyl 4-cyano-3-methyl-5-(nonanoylamino)thiophene-2-carboxylate |
| SMILES | CCCCCCCCC(=O)Nc1sc(C(=O)OC)c(C)c1C#N |
| InChI | InChI=1S/C17H24N2O3S/c1-4-5-6-7-8-9-10-14(20)19-16-13(11-18)12(2)15(23-16)17(21)22-3/h4-10H2,1-3H3,(H,19,20) |
| InChIKey | YREJEQPJXGTJHV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|