C26H32N6O4S2 — CID 4609681
N,N'-bis[3-cyano-5-(diethylcarbamoyl)-4-methylthiophen-2-yl]butanediamide (PubChem CID 4609681) has the molecular formula C26H32N6O4S2 and a molecular weight of 556.71 g/mol. Its IUPAC name is N,N'-bis[3-cyano-5-(diethylcarbamoyl)-4-methylthiophen-2-yl]butanediamide.
| Compound Name | N,N'-bis[3-cyano-5-(diethylcarbamoyl)-4-methylthiophen-2-yl]butanediamide |
|---|---|
| PubChem CID | 4609681 |
| Molecular Formula | C26H32N6O4S2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | N,N'-bis[3-cyano-5-(diethylcarbamoyl)-4-methylthiophen-2-yl]butanediamide |
| SMILES | CCN(CC)C(=O)c1sc(NC(=O)CCC(=O)Nc2sc(C(=O)N(CC)CC)c(C)c2C#N)c(C#N)c1C |
| InChI | InChI=1S/C26H32N6O4S2/c1-7-31(8-2)25(35)21-15(5)17(13-27)23(37-21)29-19(33)11-12-20(34)30-24-18(14-28)16(6)22(38-24)26(36)32(9-3)10-4/h7-12H2,1-6H3,(H,29,33)(H,30,34) |
| InChIKey | UGTQZXAWQUCMKV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 146.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |