C17H16N2O5S2 — CID 44918909
methyl 5-[3-(benzenesulfonyl)propanoylamino]-4-cyano-3-methylthiophene-2-carboxylate (PubChem CID 44918909) has the molecular formula C17H16N2O5S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is methyl 5-[3-(benzenesulfonyl)propanoylamino]-4-cyano-3-methylthiophene-2-carboxylate.
| Compound Name | methyl 5-[3-(benzenesulfonyl)propanoylamino]-4-cyano-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 44918909 |
| Molecular Formula | C17H16N2O5S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | methyl 5-[3-(benzenesulfonyl)propanoylamino]-4-cyano-3-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)CCS(=O)(=O)c2ccccc2)c(C#N)c1C |
| InChI | InChI=1S/C17H16N2O5S2/c1-11-13(10-18)16(25-15(11)17(21)24-2)19-14(20)8-9-26(22,23)12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3,(H,19,20) |
| InChIKey | HONFWMXEXDPLRZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |