C18H17FN2O5S3 — CID 41151723
ethyl 5-[3-(4-fluorophenyl)sulfonylpropanoylamino]-3-methyl-4-thiocyanatothiophene-2-carboxylate (PubChem CID 41151723) has the molecular formula C18H17FN2O5S3 and a molecular weight of 456.54 g/mol. Its IUPAC name is ethyl 5-[3-(4-fluorophenyl)sulfonylpropanoylamino]-3-methyl-4-thiocyanatothiophene-2-carboxylate.
| Compound Name | ethyl 5-[3-(4-fluorophenyl)sulfonylpropanoylamino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
|---|---|
| PubChem CID | 41151723 |
| Molecular Formula | C18H17FN2O5S3 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | ethyl 5-[3-(4-fluorophenyl)sulfonylpropanoylamino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)CCS(=O)(=O)c2ccc(F)cc2)c(SC#N)c1C |
| InChI | InChI=1S/C18H17FN2O5S3/c1-3-26-18(23)16-11(2)15(27-10-20)17(28-16)21-14(22)8-9-29(24,25)13-6-4-12(19)5-7-13/h4-7H,3,8-9H2,1-2H3,(H,21,22) |
| InChIKey | NGESOGMREFFJRA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|