C18H18N2O5S3 — CID 41044609
ethyl 5-[(4-ethylsulfonylbenzoyl)amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate (PubChem CID 41044609) has the molecular formula C18H18N2O5S3 and a molecular weight of 438.55 g/mol. Its IUPAC name is ethyl 5-[(4-ethylsulfonylbenzoyl)amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate.
| Compound Name | ethyl 5-[(4-ethylsulfonylbenzoyl)amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
|---|---|
| PubChem CID | 41044609 |
| Molecular Formula | C18H18N2O5S3 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | ethyl 5-[(4-ethylsulfonylbenzoyl)amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc(S(=O)(=O)CC)cc2)c(SC#N)c1C |
| InChI | InChI=1S/C18H18N2O5S3/c1-4-25-18(22)15-11(3)14(26-10-19)17(27-15)20-16(21)12-6-8-13(9-7-12)28(23,24)5-2/h6-9H,4-5H2,1-3H3,(H,20,21) |
| InChIKey | FDVSPKBPGPGXAC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|