C22H25N3O6S3 — CID 16833670
ethyl 3-methyl-5-[[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]amino]-4-thiocyanatothiophene-2-carboxylate (PubChem CID 16833670) has the molecular formula C22H25N3O6S3 and a molecular weight of 523.66 g/mol. Its IUPAC name is ethyl 3-methyl-5-[[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]amino]-4-thiocyanatothiophene-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]amino]-4-thiocyanatothiophene-2-carboxylate |
|---|---|
| PubChem CID | 16833670 |
| Molecular Formula | C22H25N3O6S3 |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | ethyl 3-methyl-5-[[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]amino]-4-thiocyanatothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc(S(=O)(=O)N(C)CC3CCCO3)cc2)c(SC#N)c1C |
| InChI | InChI=1S/C22H25N3O6S3/c1-4-30-22(27)19-14(2)18(32-13-23)21(33-19)24-20(26)15-7-9-17(10-8-15)34(28,29)25(3)12-16-6-5-11-31-16/h7-10,16H,4-6,11-12H2,1-3H3,(H,24,26) |
| InChIKey | RSQFMMIAJHKBOM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|