C22H27N3O5S3 — CID 23820887
ethyl 5-[[4-(dipropylsulfamoyl)benzoyl]amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate (PubChem CID 23820887) has the molecular formula C22H27N3O5S3 and a molecular weight of 509.68 g/mol. Its IUPAC name is ethyl 5-[[4-(dipropylsulfamoyl)benzoyl]amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate.
| Compound Name | ethyl 5-[[4-(dipropylsulfamoyl)benzoyl]amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
|---|---|
| PubChem CID | 23820887 |
| Molecular Formula | C22H27N3O5S3 |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | ethyl 5-[[4-(dipropylsulfamoyl)benzoyl]amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)Nc2sc(C(=O)OCC)c(C)c2SC#N)cc1 |
| InChI | InChI=1S/C22H27N3O5S3/c1-5-12-25(13-6-2)33(28,29)17-10-8-16(9-11-17)20(26)24-21-18(31-14-23)15(4)19(32-21)22(27)30-7-3/h8-11H,5-7,12-13H2,1-4H3,(H,24,26) |
| InChIKey | GTKPXHDCMDPCJE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|