C24H28N2O7S2 — CID 23856517
diethyl 5-[[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 23856517) has the molecular formula C24H28N2O7S2 and a molecular weight of 520.63 g/mol. Its IUPAC name is diethyl 5-[[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 23856517 |
| Molecular Formula | C24H28N2O7S2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | diethyl 5-[[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)Nc2sc(C(=O)OCC)c(C)c2C(=O)OCC)cc1 |
| InChI | InChI=1S/C24H28N2O7S2/c1-6-14-26(15-7-2)35(30,31)18-12-10-17(11-13-18)21(27)25-22-19(23(28)32-8-3)16(5)20(34-22)24(29)33-9-4/h6-7,10-13H,1-2,8-9,14-15H2,3-5H3,(H,25,27) |
| InChIKey | VRYRQXQIZRAMLY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|