C20H21N3O7S2 — CID 23936751
ethyl 2-[[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]amino]-5-nitrothiophene-3-carboxylate (PubChem CID 23936751) has the molecular formula C20H21N3O7S2 and a molecular weight of 479.54 g/mol. Its IUPAC name is ethyl 2-[[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]amino]-5-nitrothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]amino]-5-nitrothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23936751 |
| Molecular Formula | C20H21N3O7S2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | ethyl 2-[[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]amino]-5-nitrothiophene-3-carboxylate |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)Nc2sc([N+](=O)[O-])cc2C(=O)OCC)cc1 |
| InChI | InChI=1S/C20H21N3O7S2/c1-4-11-22(12-5-2)32(28,29)15-9-7-14(8-10-15)18(24)21-19-16(20(25)30-6-3)13-17(31-19)23(26)27/h4-5,7-10,13H,1-2,6,11-12H2,3H3,(H,21,24) |
| InChIKey | XOGZKTGRSHZAMP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|