C14H10ClN3O7S — CID 23931529
ethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5-nitrothiophene-3-carboxylate (PubChem CID 23931529) has the molecular formula C14H10ClN3O7S and a molecular weight of 399.77 g/mol. Its IUPAC name is ethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5-nitrothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5-nitrothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23931529 |
| Molecular Formula | C14H10ClN3O7S |
| Molecular Weight | 399.77 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | ethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5-nitrothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])sc1NC(=O)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10ClN3O7S/c1-2-25-14(20)9-6-11(18(23)24)26-13(9)16-12(19)8-5-7(15)3-4-10(8)17(21)22/h3-6H,2H2,1H3,(H,16,19) |
| InChIKey | DRQCIQRENXLCJV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.77 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|