C20H20ClN3O7S — CID 4148164
diethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (PubChem CID 4148164) has the molecular formula C20H20ClN3O7S and a molecular weight of 481.91 g/mol. Its IUPAC name is diethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate.
| Compound Name | diethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 4148164 |
| Molecular Formula | C20H20ClN3O7S |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | diethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cc(Cl)ccc2[N+](=O)[O-])sc2c1CCN(C(=O)OCC)C2 |
| InChI | InChI=1S/C20H20ClN3O7S/c1-3-30-19(26)16-12-7-8-23(20(27)31-4-2)10-15(12)32-18(16)22-17(25)13-9-11(21)5-6-14(13)24(28)29/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,22,25) |
| InChIKey | MWQRISZOPBMVND-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|