C18H16ClN3O7S — CID 41017949
dimethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (PubChem CID 41017949) has the molecular formula C18H16ClN3O7S and a molecular weight of 453.86 g/mol. Its IUPAC name is dimethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate.
| Compound Name | dimethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 41017949 |
| Molecular Formula | C18H16ClN3O7S |
| Molecular Weight | 453.86 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | dimethyl 2-[(5-chloro-2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cc(Cl)ccc2[N+](=O)[O-])sc2c1CCN(C(=O)OC)C2 |
| InChI | InChI=1S/C18H16ClN3O7S/c1-28-17(24)14-10-5-6-21(18(25)29-2)8-13(10)30-16(14)20-15(23)11-7-9(19)3-4-12(11)22(26)27/h3-4,7H,5-6,8H2,1-2H3,(H,20,23) |
| InChIKey | XWPCECCMTGJSQQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.86 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|