C17H14N4O5S — CID 7589099
methyl 3-cyano-2-[(2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 7589099) has the molecular formula C17H14N4O5S and a molecular weight of 386.39 g/mol. Its IUPAC name is methyl 3-cyano-2-[(2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | methyl 3-cyano-2-[(2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 7589099 |
| Molecular Formula | C17H14N4O5S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | methyl 3-cyano-2-[(2-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | COC(=O)N1CCc2c(sc(NC(=O)c3ccccc3[N+](=O)[O-])c2C#N)C1 |
| InChI | InChI=1S/C17H14N4O5S/c1-26-17(23)20-7-6-10-12(8-18)16(27-14(10)9-20)19-15(22)11-4-2-3-5-13(11)21(24)25/h2-5H,6-7,9H2,1H3,(H,19,22) |
| InChIKey | ILAYGQSAWBHMJX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|