C23H20N4O3S — CID 43950676
N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-methyl-3-nitrobenzamide (PubChem CID 43950676) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-methyl-3-nitrobenzamide.
| Compound Name | N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43950676 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-methyl-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)Nc2sc3c(c2C#N)CCN(Cc2ccccc2)C3)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H20N4O3S/c1-15-17(8-5-9-20(15)27(29)30)22(28)25-23-19(12-24)18-10-11-26(14-21(18)31-23)13-16-6-3-2-4-7-16/h2-9H,10-11,13-14H2,1H3,(H,25,28) |
| InChIKey | ILFRMXKNPXICIS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|