C17H15ClN4O6S — CID 41018133
methyl 3-carbamoyl-2-[(2-chloro-5-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 41018133) has the molecular formula C17H15ClN4O6S and a molecular weight of 438.85 g/mol. Its IUPAC name is methyl 3-carbamoyl-2-[(2-chloro-5-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | methyl 3-carbamoyl-2-[(2-chloro-5-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 41018133 |
| Molecular Formula | C17H15ClN4O6S |
| Molecular Weight | 438.85 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | methyl 3-carbamoyl-2-[(2-chloro-5-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | COC(=O)N1CCc2c(sc(NC(=O)c3cc([N+](=O)[O-])ccc3Cl)c2C(N)=O)C1 |
| InChI | InChI=1S/C17H15ClN4O6S/c1-28-17(25)21-5-4-9-12(7-21)29-16(13(9)14(19)23)20-15(24)10-6-8(22(26)27)2-3-11(10)18/h2-3,6H,4-5,7H2,1H3,(H2,19,23)(H,20,24) |
| InChIKey | PIKPNDVYSKVVKR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|