C21H14N2O7S — CID 23993794
ethyl 5-nitro-2-[(3-oxobenzo[f]chromene-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 23993794) has the molecular formula C21H14N2O7S and a molecular weight of 438.42 g/mol. Its IUPAC name is ethyl 5-nitro-2-[(3-oxobenzo[f]chromene-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-nitro-2-[(3-oxobenzo[f]chromene-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23993794 |
| Molecular Formula | C21H14N2O7S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | ethyl 5-nitro-2-[(3-oxobenzo[f]chromene-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])sc1NC(=O)c1cc2c(ccc3ccccc32)oc1=O |
| InChI | InChI=1S/C21H14N2O7S/c1-2-29-20(25)15-10-17(23(27)28)31-19(15)22-18(24)14-9-13-12-6-4-3-5-11(12)7-8-16(13)30-21(14)26/h3-10H,2H2,1H3,(H,22,24) |
| InChIKey | JSYOPKQINIYPDS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|