C27H19NO5S — CID 19132762
ethyl 2-[(3-oxobenzo[f]chromene-2-carbonyl)amino]-4-phenylthiophene-3-carboxylate (PubChem CID 19132762) has the molecular formula C27H19NO5S and a molecular weight of 469.52 g/mol. Its IUPAC name is ethyl 2-[(3-oxobenzo[f]chromene-2-carbonyl)amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3-oxobenzo[f]chromene-2-carbonyl)amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19132762 |
| Molecular Formula | C27H19NO5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | ethyl 2-[(3-oxobenzo[f]chromene-2-carbonyl)amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1cc2c(ccc3ccccc32)oc1=O |
| InChI | InChI=1S/C27H19NO5S/c1-2-32-27(31)23-21(16-8-4-3-5-9-16)15-34-25(23)28-24(29)20-14-19-18-11-7-6-10-17(18)12-13-22(19)33-26(20)30/h3-15H,2H2,1H3,(H,28,29) |
| InChIKey | ZFZKSRNHNODZEV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|