C23H14N2O3S — CID 3953765
3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)benzo[f]chromene-2-carboxamide (PubChem CID 3953765) has the molecular formula C23H14N2O3S and a molecular weight of 398.44 g/mol. Its IUPAC name is 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)benzo[f]chromene-2-carboxamide.
| Compound Name | 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)benzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 3953765 |
| Molecular Formula | C23H14N2O3S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)benzo[f]chromene-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1cc2c(ccc3ccccc32)oc1=O |
| InChI | InChI=1S/C23H14N2O3S/c26-21(25-23-24-19(13-29-23)15-7-2-1-3-8-15)18-12-17-16-9-5-4-6-14(16)10-11-20(17)28-22(18)27/h1-13H,(H,24,25,26) |
| InChIKey | VXBDYEYDHHBPKT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|