C18H12N2O4 — CID 19154798
N-(5-methyl-1,2-oxazol-3-yl)-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 19154798) has the molecular formula C18H12N2O4 and a molecular weight of 320.30 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 19154798 |
| Molecular Formula | C18H12N2O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc3c(ccc4ccccc43)oc2=O)no1 |
| InChI | InChI=1S/C18H12N2O4/c1-10-8-16(20-24-10)19-17(21)14-9-13-12-5-3-2-4-11(12)6-7-15(13)23-18(14)22/h2-9H,1H3,(H,19,20,21) |
| InChIKey | OARBYQNGUFTLRZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|