C20H14N2O3 — CID 827865
N-(3-methyl-2-pyridinyl)-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 827865) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-(3-methyl-2-pyridinyl)-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-(3-methyl-2-pyridinyl)-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 827865 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-(3-methyl-2-pyridinyl)-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | Cc1cccnc1NC(=O)c1cc2c(ccc3ccccc32)oc1=O |
| InChI | InChI=1S/C20H14N2O3/c1-12-5-4-10-21-18(12)22-19(23)16-11-15-14-7-3-2-6-13(14)8-9-17(15)25-20(16)24/h2-11H,1H3,(H,21,22,23) |
| InChIKey | IYIVIKSNJNRSQB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|