C24H17NO7 — CID 6616120
dimethyl 5-[(3-oxobenzo[f]chromene-2-carbonyl)amino]benzene-1,3-dicarboxylate (PubChem CID 6616120) has the molecular formula C24H17NO7 and a molecular weight of 431.40 g/mol. Its IUPAC name is dimethyl 5-[(3-oxobenzo[f]chromene-2-carbonyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(3-oxobenzo[f]chromene-2-carbonyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 6616120 |
| Molecular Formula | C24H17NO7 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | dimethyl 5-[(3-oxobenzo[f]chromene-2-carbonyl)amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2cc3c(ccc4ccccc43)oc2=O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C24H17NO7/c1-30-22(27)14-9-15(23(28)31-2)11-16(10-14)25-21(26)19-12-18-17-6-4-3-5-13(17)7-8-20(18)32-24(19)29/h3-12H,1-2H3,(H,25,26) |
| InChIKey | PPFKQEWWLWYPHE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|