C23H15N3O4 — CID 16917380
N-(5-benzyl-1,3,4-oxadiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 16917380) has the molecular formula C23H15N3O4 and a molecular weight of 397.39 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-oxadiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-(5-benzyl-1,3,4-oxadiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 16917380 |
| Molecular Formula | C23H15N3O4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-(5-benzyl-1,3,4-oxadiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | O=C(Nc1nnc(Cc2ccccc2)o1)c1cc2c(ccc3ccccc32)oc1=O |
| InChI | InChI=1S/C23H15N3O4/c27-21(24-23-26-25-20(30-23)12-14-6-2-1-3-7-14)18-13-17-16-9-5-4-8-15(16)10-11-19(17)29-22(18)28/h1-11,13H,12H2,(H,24,26,27) |
| InChIKey | KNXNFGRKHOXKQN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|