C24H17N3O4S — CID 43974028
N-[5-[(4-methylsulfanylphenyl)methyl]-1,3,4-oxadiazol-2-yl]-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 43974028) has the molecular formula C24H17N3O4S and a molecular weight of 443.48 g/mol. Its IUPAC name is N-[5-[(4-methylsulfanylphenyl)methyl]-1,3,4-oxadiazol-2-yl]-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[5-[(4-methylsulfanylphenyl)methyl]-1,3,4-oxadiazol-2-yl]-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 43974028 |
| Molecular Formula | C24H17N3O4S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | N-[5-[(4-methylsulfanylphenyl)methyl]-1,3,4-oxadiazol-2-yl]-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | CSc1ccc(Cc2nnc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)o2)cc1 |
| InChI | InChI=1S/C24H17N3O4S/c1-32-16-9-6-14(7-10-16)12-21-26-27-24(31-21)25-22(28)19-13-18-17-5-3-2-4-15(17)8-11-20(18)30-23(19)29/h2-11,13H,12H2,1H3,(H,25,27,28) |
| InChIKey | JXBVJZXIOSTLCY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|