C26H21N3O6S — CID 43974843
3-oxo-N-[5-[(4-propan-2-ylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]benzo[f]chromene-2-carboxamide (PubChem CID 43974843) has the molecular formula C26H21N3O6S and a molecular weight of 503.54 g/mol. Its IUPAC name is 3-oxo-N-[5-[(4-propan-2-ylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]benzo[f]chromene-2-carboxamide.
| Compound Name | 3-oxo-N-[5-[(4-propan-2-ylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]benzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 43974843 |
| Molecular Formula | C26H21N3O6S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 3-oxo-N-[5-[(4-propan-2-ylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]benzo[f]chromene-2-carboxamide |
| SMILES | CC(C)S(=O)(=O)c1ccc(Cc2nnc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)o2)cc1 |
| InChI | InChI=1S/C26H21N3O6S/c1-15(2)36(32,33)18-10-7-16(8-11-18)13-23-28-29-26(35-23)27-24(30)21-14-20-19-6-4-3-5-17(19)9-12-22(20)34-25(21)31/h3-12,14-15H,13H2,1-2H3,(H,27,29,30) |
| InChIKey | OTWIMBRRCFTOAX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|