C24H18N4O6S — CID 43977553
N-[5-[4-(dimethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 43977553) has the molecular formula C24H18N4O6S and a molecular weight of 490.50 g/mol. Its IUPAC name is N-[5-[4-(dimethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[5-[4-(dimethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 43977553 |
| Molecular Formula | C24H18N4O6S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-[5-[4-(dimethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2nnc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)o2)cc1 |
| InChI | InChI=1S/C24H18N4O6S/c1-28(2)35(31,32)16-10-7-15(8-11-16)22-26-27-24(34-22)25-21(29)19-13-18-17-6-4-3-5-14(17)9-12-20(18)33-23(19)30/h3-13H,1-2H3,(H,25,27,29) |
| InChIKey | SDFAOBCHBCFGFV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|