C19H13N3O6S — CID 7578257
N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-2-oxochromene-3-carboxamide (PubChem CID 7578257) has the molecular formula C19H13N3O6S and a molecular weight of 411.40 g/mol. Its IUPAC name is N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 7578257 |
| Molecular Formula | C19H13N3O6S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-2-oxochromene-3-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(-c2nnc(NC(=O)c3cc4ccccc4oc3=O)o2)c1 |
| InChI | InChI=1S/C19H13N3O6S/c1-29(25,26)13-7-4-6-12(9-13)17-21-22-19(28-17)20-16(23)14-10-11-5-2-3-8-15(11)27-18(14)24/h2-10H,1H3,(H,20,22,23) |
| InChIKey | QIYMHXJSHVBQER-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|