C20H15N3O6 — CID 16854172
N-[5-(2,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-oxochromene-3-carboxamide (PubChem CID 16854172) has the molecular formula C20H15N3O6 and a molecular weight of 393.36 g/mol. Its IUPAC name is N-[5-(2,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[5-(2,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 16854172 |
| Molecular Formula | C20H15N3O6 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-[5-(2,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(OC)c(-c2nnc(NC(=O)c3cc4ccccc4oc3=O)o2)c1 |
| InChI | InChI=1S/C20H15N3O6/c1-26-12-7-8-16(27-2)13(10-12)18-22-23-20(29-18)21-17(24)14-9-11-5-3-4-6-15(11)28-19(14)25/h3-10H,1-2H3,(H,21,23,24) |
| InChIKey | UJAAGDLZUJRSIE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|