C25H18N4O2 — CID 53323751
N-(5-benzyl-1,3,4-oxadiazol-2-yl)-2-phenylquinoline-4-carboxamide (PubChem CID 53323751) has the molecular formula C25H18N4O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-oxadiazol-2-yl)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(5-benzyl-1,3,4-oxadiazol-2-yl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 53323751 |
| Molecular Formula | C25H18N4O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-(5-benzyl-1,3,4-oxadiazol-2-yl)-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(Nc1nnc(Cc2ccccc2)o1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C25H18N4O2/c30-24(27-25-29-28-23(31-25)15-17-9-3-1-4-10-17)20-16-22(18-11-5-2-6-12-18)26-21-14-8-7-13-19(20)21/h1-14,16H,15H2,(H,27,29,30) |
| InChIKey | AIGSXPWRDDHJTH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |