C19H14N2O — CID 17474136
2-phenyl-N-prop-2-ynylquinoline-4-carboxamide (PubChem CID 17474136) has the molecular formula C19H14N2O and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-phenyl-N-prop-2-ynylquinoline-4-carboxamide.
| Compound Name | 2-phenyl-N-prop-2-ynylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 17474136 |
| Molecular Formula | C19H14N2O |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-phenyl-N-prop-2-ynylquinoline-4-carboxamide |
| SMILES | C#CCNC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C19H14N2O/c1-2-12-20-19(22)16-13-18(14-8-4-3-5-9-14)21-17-11-7-6-10-15(16)17/h1,3-11,13H,12H2,(H,20,22) |
| InChIKey | YDMMJKSFXUCPMX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|