C19H13N3O2 — CID 899144
N-(1,2-oxazol-3-yl)-2-phenylquinoline-4-carboxamide (PubChem CID 899144) has the molecular formula C19H13N3O2 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-(1,2-oxazol-3-yl)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(1,2-oxazol-3-yl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 899144 |
| Molecular Formula | C19H13N3O2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-(1,2-oxazol-3-yl)-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(Nc1ccon1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C19H13N3O2/c23-19(21-18-10-11-24-22-18)15-12-17(13-6-2-1-3-7-13)20-16-9-5-4-8-14(15)16/h1-12H,(H,21,22,23) |
| InChIKey | CDDDIKSIXQVQAT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |