C21H15N3O2 — CID 51114321
N-(4-oxo-1H-pyridin-3-yl)-2-phenylquinoline-4-carboxamide (PubChem CID 51114321) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-(4-oxo-1H-pyridin-3-yl)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(4-oxo-1H-pyridin-3-yl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 51114321 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-(4-oxo-1H-pyridin-3-yl)-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(Nc1c[nH]ccc1=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C21H15N3O2/c25-20-10-11-22-13-19(20)24-21(26)16-12-18(14-6-2-1-3-7-14)23-17-9-5-4-8-15(16)17/h1-13H,(H,22,25)(H,24,26) |
| InChIKey | WZSYAWUWIZOXCB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |