C27H19BrN2O4S — CID 19289158
ethyl 4-(4-bromophenyl)-2-[(3-iminobenzo[f]chromene-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 19289158) has the molecular formula C27H19BrN2O4S and a molecular weight of 547.43 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-2-[(3-iminobenzo[f]chromene-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-2-[(3-iminobenzo[f]chromene-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19289158 |
| Molecular Formula | C27H19BrN2O4S |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 546.02 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-2-[(3-iminobenzo[f]chromene-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | [H]/N=c1\oc2ccc3ccccc3c2cc1C(=O)Nc1scc(-c2ccc(Br)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C27H19BrN2O4S/c1-2-33-27(32)23-21(16-7-10-17(28)11-8-16)14-35-26(23)30-25(31)20-13-19-18-6-4-3-5-15(18)9-12-22(19)34-24(20)29/h3-14,29H,2H2,1H3,(H,30,31)/b29-24- |
| InChIKey | RSQCJKJSEGUJHB-OLFWJLLRSA-N |
| XLogP | 6.99 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|