C25H22N2O5S — CID 17281923
methyl 2-[(8-ethoxy-2-iminochromene-3-carbonyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 17281923) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is methyl 2-[(8-ethoxy-2-iminochromene-3-carbonyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(8-ethoxy-2-iminochromene-3-carbonyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17281923 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | methyl 2-[(8-ethoxy-2-iminochromene-3-carbonyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | [H]/N=c1\oc2c(OCC)cccc2cc1C(=O)Nc1scc(-c2ccc(C)cc2)c1C(=O)OC |
| InChI | InChI=1S/C25H22N2O5S/c1-4-31-19-7-5-6-16-12-17(22(26)32-21(16)19)23(28)27-24-20(25(29)30-3)18(13-33-24)15-10-8-14(2)9-11-15/h5-13,26H,4H2,1-3H3,(H,27,28)/b26-22- |
| InChIKey | VLEFVAYJWUCAOV-ROMGYVFFSA-N |
| XLogP | 5.39 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|