C18H16N2O5S — CID 19572236
methyl 5-ethyl-2-[(8-hydroxy-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 19572236) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is methyl 5-ethyl-2-[(8-hydroxy-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-ethyl-2-[(8-hydroxy-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19572236 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | methyl 5-ethyl-2-[(8-hydroxy-2-iminochromene-3-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | [H]/N=c1\oc2c(O)cccc2cc1C(=O)Nc1sc(CC)cc1C(=O)OC |
| InChI | InChI=1S/C18H16N2O5S/c1-3-10-8-12(18(23)24-2)17(26-10)20-16(22)11-7-9-5-4-6-13(21)14(9)25-15(11)19/h4-8,19,21H,3H2,1-2H3,(H,20,22)/b19-15- |
| InChIKey | YWZCJPNRYOYPCJ-CYVLTUHYSA-N |
| XLogP | 3.28 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |